C25H22N4O5S — CID 3114226
benzyl N-[1-[(6-methyl-1,3-benzothiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 3114226) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is benzyl N-[1-[(6-methyl-1,3-benzothiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(6-methyl-1,3-benzothiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 3114226 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | benzyl N-[1-[(6-methyl-1,3-benzothiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1ccc2nc(NC(=O)C(Cc3ccc([N+](=O)[O-])cc3)NC(=O)OCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C25H22N4O5S/c1-16-7-12-20-22(13-16)35-24(26-20)28-23(30)21(14-17-8-10-19(11-9-17)29(32)33)27-25(31)34-15-18-5-3-2-4-6-18/h2-13,21H,14-15H2,1H3,(H,27,31)(H,26,28,30) |
| InChIKey | MLKDHRLAIOOMKW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|