C21H20N4O5S — CID 44724372
benzyl N-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 44724372) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is benzyl N-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 44724372 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | benzyl N-[1-[(4-methyl-1,3-thiazol-2-yl)amino]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1csc(NC(=O)C(Cc2ccc([N+](=O)[O-])cc2)NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C21H20N4O5S/c1-14-13-31-20(22-14)24-19(26)18(11-15-7-9-17(10-8-15)25(28)29)23-21(27)30-12-16-5-3-2-4-6-16/h2-10,13,18H,11-12H2,1H3,(H,23,27)(H,22,24,26) |
| InChIKey | PDJOZEPXKWQUIM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|