C30H28N4O9S2 — CID 172570615
4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-(4-methyl-2,6-dioxopiperidin-1-yl)phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 172570615) has the molecular formula C30H28N4O9S2 and a molecular weight of 652.71 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-(4-methyl-2,6-dioxopiperidin-1-yl)phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-(4-methyl-2,6-dioxopiperidin-1-yl)phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 172570615 |
| Molecular Formula | C30H28N4O9S2 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.13 |
| IUPAC Name | 4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-(4-methyl-2,6-dioxopiperidin-1-yl)phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(-c2ccc(N3C(=O)CC(C)CC3=O)c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C30H28N4O9S2/c1-15-10-26(35)34(27(36)11-15)23-9-5-19(13-17(23)3)18-4-7-21(16(2)12-18)32-33-22-8-6-20-24(44(38,39)40)14-25(45(41,42)43)29(31)28(20)30(22)37/h4-9,12-15,37H,10-11,31H2,1-3H3,(H,38,39,40)(H,41,42,43)/b33-32+ |
| InChIKey | CAAXUWNJAUIKGM-ULIFNZDWSA-N |
| XLogP | 5.61 |
| TPSA | 217.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|