C33H30N6O11S2 — CID 137245368
4-amino-6-[[4-[4-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid (PubChem CID 137245368) has the molecular formula C33H30N6O11S2 and a molecular weight of 750.77 g/mol. Its IUPAC name is 4-amino-6-[[4-[4-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-6-[[4-[4-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 137245368 |
| Molecular Formula | C33H30N6O11S2 |
| Molecular Weight | 750.77 g/mol |
| Exact Mass | 750.14 |
| IUPAC Name | 4-amino-6-[[4-[4-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
| SMILES | Cc1cc(-c2ccc(NC(=O)CNC(=O)CCN3C(=O)C=CC3=O)c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C33H30N6O11S2/c1-17-13-19(3-6-22(17)36-28(41)16-35-27(40)11-12-39-29(42)9-10-30(39)43)20-4-7-23(18(2)14-20)37-38-24-8-5-21-25(51(45,46)47)15-26(52(48,49)50)32(34)31(21)33(24)44/h3-10,13-15,44H,11-12,16,34H2,1-2H3,(H,35,40)(H,36,41)(H,45,46,47)(H,48,49,50)/b38-37+ |
| InChIKey | DYRYUAVYUQLJDU-HEFFKOSUSA-N |
| XLogP | 3.69 |
| TPSA | 275.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|