C32H31N5O10S3 — CID 163623851
4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 163623851) has the molecular formula C32H31N5O10S3 and a molecular weight of 741.83 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 163623851 |
| Molecular Formula | C32H31N5O10S3 |
| Molecular Weight | 741.83 g/mol |
| Exact Mass | 741.12 |
| IUPAC Name | 4-amino-5-hydroxy-6-[[2-methyl-4-[3-methyl-4-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]phenyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | CSC1CC(=O)N(CCC(=O)Nc2ccc(-c3ccc(/N=N/c4ccc5c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c5c4O)c(C)c3)cc2C)C1=O |
| InChI | InChI=1S/C32H31N5O10S3/c1-16-12-18(4-7-21(16)34-27(38)10-11-37-28(39)14-24(48-3)32(37)41)19-5-8-22(17(2)13-19)35-36-23-9-6-20-25(49(42,43)44)15-26(50(45,46)47)30(33)29(20)31(23)40/h4-9,12-13,15,24,40H,10-11,14,33H2,1-3H3,(H,34,38)(H,42,43,44)(H,45,46,47)/b36-35+ |
| InChIKey | HQKKIVWZPWPPFR-ULDVOPSXSA-N |
| XLogP | 5.14 |
| TPSA | 246.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|