C28H27N7O8S2 — CID 176887530
4-amino-6-[[4-[4-(6-azidohexanoylamino)phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid (PubChem CID 176887530) has the molecular formula C28H27N7O8S2 and a molecular weight of 653.70 g/mol. Its IUPAC name is 4-amino-6-[[4-[4-(6-azidohexanoylamino)phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-6-[[4-[4-(6-azidohexanoylamino)phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 176887530 |
| Molecular Formula | C28H27N7O8S2 |
| Molecular Weight | 653.70 g/mol |
| Exact Mass | 653.14 |
| IUPAC Name | 4-amino-6-[[4-[4-(6-azidohexanoylamino)phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
| SMILES | [N-]=[N+]=NCCCCCC(=O)Nc1ccc(-c2ccc(/N=N/c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c4c3O)cc2)cc1 |
| InChI | InChI=1S/C28H27N7O8S2/c29-27-24(45(41,42)43)16-23(44(38,39)40)21-13-14-22(28(37)26(21)27)34-33-20-11-7-18(8-12-20)17-5-9-19(10-6-17)32-25(36)4-2-1-3-15-31-35-30/h5-14,16,37H,1-4,15,29H2,(H,32,36)(H,38,39,40)(H,41,42,43)/b34-33+ |
| InChIKey | ONGUOEYUNXSPKY-JEIPZWNWSA-N |
| XLogP | 6.51 |
| TPSA | 257.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.70 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|