C24H19N6NaO5S — CID 135666601
sodium 3-[(4-acetamidophenyl)diazenyl]-4-amino-5-hydroxy-6-phenyldiazenylnaphthalene-1-sulfonate (PubChem CID 135666601) has the molecular formula C24H19N6NaO5S and a molecular weight of 526.51 g/mol. Its IUPAC name is sodium 3-[(4-acetamidophenyl)diazenyl]-4-amino-5-hydroxy-6-phenyldiazenylnaphthalene-1-sulfonate.
| Compound Name | sodium 3-[(4-acetamidophenyl)diazenyl]-4-amino-5-hydroxy-6-phenyldiazenylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 135666601 |
| Molecular Formula | C24H19N6NaO5S |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | sodium 3-[(4-acetamidophenyl)diazenyl]-4-amino-5-hydroxy-6-phenyldiazenylnaphthalene-1-sulfonate |
| SMILES | CC(=O)Nc1ccc(/N=N/c2cc(S(=O)(=O)[O-])c3ccc(/N=N/c4ccccc4)c(O)c3c2N)cc1.[Na+] |
| InChI | InChI=1S/C24H20N6O5S.Na/c1-14(31)26-15-7-9-17(10-8-15)28-30-20-13-21(36(33,34)35)18-11-12-19(24(32)22(18)23(20)25)29-27-16-5-3-2-4-6-16;/h2-13,32H,25H2,1H3,(H,26,31)(H,33,34,35);/q;+1/p-1/b29-27+,30-28+; |
| InChIKey | JZEMDMQSSTZESF-MANJTEISSA-M |
| XLogP | 2.82 |
| TPSA | 181.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|