C28H28N4O8S2 — CID 155428891
4-amino-6-[[4-[4-(butanoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid (PubChem CID 155428891) has the molecular formula C28H28N4O8S2 and a molecular weight of 612.69 g/mol. Its IUPAC name is 4-amino-6-[[4-[4-(butanoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid.
| Compound Name | 4-amino-6-[[4-[4-(butanoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 155428891 |
| Molecular Formula | C28H28N4O8S2 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 4-amino-6-[[4-[4-(butanoylamino)-3-methylphenyl]-2-methylphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid |
| SMILES | CCCC(=O)Nc1ccc(-c2ccc(/N=N/c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c4c3O)c(C)c2)cc1C |
| InChI | InChI=1S/C28H28N4O8S2/c1-4-5-25(33)30-20-9-6-17(12-15(20)2)18-7-10-21(16(3)13-18)31-32-22-11-8-19-23(41(35,36)37)14-24(42(38,39)40)27(29)26(19)28(22)34/h6-14,34H,4-5,29H2,1-3H3,(H,30,33)(H,35,36,37)(H,38,39,40)/b32-31+ |
| InChIKey | QMEVATLEBDWDKN-QNEJGDQOSA-N |
| XLogP | 6.06 |
| TPSA | 208.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|