C16H11N2NaO6S — CID 136917536
sodium 4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenolate (PubChem CID 136917536) has the molecular formula C16H11N2NaO6S and a molecular weight of 382.33 g/mol. Its IUPAC name is sodium 4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenolate.
| Compound Name | sodium 4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenolate |
|---|---|
| PubChem CID | 136917536 |
| Molecular Formula | C16H11N2NaO6S |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | sodium 4-[(1,8-dihydroxy-4-sulfonaphthalen-2-yl)diazenyl]phenolate |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2ccc([O-])cc2)c(O)c2c(O)cccc12.[Na+] |
| InChI | InChI=1S/C16H12N2O6S.Na/c19-10-6-4-9(5-7-10)17-18-12-8-14(25(22,23)24)11-2-1-3-13(20)15(11)16(12)21;/h1-8,19-21H,(H,22,23,24);/q;+1/p-1/b18-17+; |
| InChIKey | AIAJLSGASRGBIL-ZAGWXBKKSA-M |
| XLogP | -0.01 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|