C34H24N6O6S2 — CID 2750502
4-amino-3-[[4-[2-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]ethynyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 2750502) has the molecular formula C34H24N6O6S2 and a molecular weight of 676.74 g/mol. Its IUPAC name is 4-amino-3-[[4-[2-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]ethynyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[2-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]ethynyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 2750502 |
| Molecular Formula | C34H24N6O6S2 |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.12 |
| IUPAC Name | 4-amino-3-[[4-[2-[4-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl]phenyl]ethynyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(C#Cc3ccc(/N=N/c4cc(S(=O)(=O)O)c5ccccc5c4N)cc3)cc2)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C34H24N6O6S2/c35-33-27-7-3-1-5-25(27)31(47(41,42)43)19-29(33)39-37-23-15-11-21(12-16-23)9-10-22-13-17-24(18-14-22)38-40-30-20-32(48(44,45)46)26-6-2-4-8-28(26)34(30)36/h1-8,11-20H,35-36H2,(H,41,42,43)(H,44,45,46)/b39-37+,40-38+ |
| InChIKey | YJBUMEFNAJFCRJ-HVMBLDELSA-N |
| XLogP | 7.88 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|