C32H23N5O7S2 — CID 74089549
4-amino-3-[[4-[4-[2-(2-oxo-8-sulfonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 74089549) has the molecular formula C32H23N5O7S2 and a molecular weight of 653.70 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[2-(2-oxo-8-sulfonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[2-(2-oxo-8-sulfonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 74089549 |
| Molecular Formula | C32H23N5O7S2 |
| Molecular Weight | 653.70 g/mol |
| Exact Mass | 653.10 |
| IUPAC Name | 4-amino-3-[[4-[4-[2-(2-oxo-8-sulfonaphthalen-1-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(NN=C4C(=O)C=Cc5cccc(S(=O)(=O)O)c54)cc3)cc2)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C32H23N5O7S2/c33-31-25-6-2-1-5-24(25)29(46(42,43)44)18-26(31)36-34-22-13-8-19(9-14-22)20-10-15-23(16-11-20)35-37-32-27(38)17-12-21-4-3-7-28(30(21)32)45(39,40)41/h1-18,35H,33H2,(H,39,40,41)(H,42,43,44)/b36-34+,37-32? |
| InChIKey | YQYDFDBRPYCKPU-YVFPBXNDSA-N |
| XLogP | 6.41 |
| TPSA | 200.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|