C38H28N8O10S3 — CID 5464755
(6E)-4-amino-3-[[4-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid (PubChem CID 5464755) has the molecular formula C38H28N8O10S3 and a molecular weight of 852.89 g/mol. Its IUPAC name is (6E)-4-amino-3-[[4-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid.
| Compound Name | (6E)-4-amino-3-[[4-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 5464755 |
| Molecular Formula | C38H28N8O10S3 |
| Molecular Weight | 852.89 g/mol |
| Exact Mass | 852.11 |
| IUPAC Name | (6E)-4-amino-3-[[4-[4-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]phenyl]diazenyl]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(N)c5cc(S(=O)(=O)O)ccc45)cc3)cc2)c(S(=O)(=O)O)cc2c1C(=O)/C(=N\Nc1ccccc1)C(S(=O)(=O)O)=C2 |
| InChI | InChI=1S/C38H28N8O10S3/c39-30-16-17-31(28-15-14-27(20-29(28)30)57(48,49)50)44-41-25-10-6-21(7-11-25)22-8-12-26(13-9-22)43-45-36-32(58(51,52)53)18-23-19-33(59(54,55)56)37(38(47)34(23)35(36)40)46-42-24-4-2-1-3-5-24/h1-20,42H,39-40H2,(H,48,49,50)(H,51,52,53)(H,54,55,56)/b44-41+,45-43+,46-37- |
| InChIKey | HTBZKJCYJQYEET-XYHVBSTNSA-N |
| XLogP | 7.89 |
| TPSA | 306.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.89 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|