C32H25N9O7S2 — CID 6811642
3-[[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonic acid (PubChem CID 6811642) has the molecular formula C32H25N9O7S2 and a molecular weight of 711.74 g/mol. Its IUPAC name is 3-[[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonic acid.
| Compound Name | 3-[[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 6811642 |
| Molecular Formula | C32H25N9O7S2 |
| Molecular Weight | 711.74 g/mol |
| Exact Mass | 711.13 |
| IUPAC Name | 3-[[4-[(4-amino-7-sulfonaphthalen-1-yl)diazenyl]phenyl]hydrazinylidene]-6-[(2,4-diaminophenyl)diazenyl]-4-oxonaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc3c(c2)C(=O)C(=NNc2ccc(/N=N/c4ccc(N)c5ccc(S(=O)(=O)O)cc45)cc2)C(S(=O)(=O)O)=C3)c(N)c1 |
| InChI | InChI=1S/C32H25N9O7S2/c33-18-2-11-29(27(35)14-18)40-38-21-3-1-17-13-30(50(46,47)48)31(32(42)24(17)15-21)41-37-20-6-4-19(5-7-20)36-39-28-12-10-26(34)23-9-8-22(16-25(23)28)49(43,44)45/h1-16,37H,33-35H2,(H,43,44,45)(H,46,47,48)/b39-36+,40-38+,41-31? |
| InChIKey | YGEBKOZJUXEBBK-DRAHAMLDSA-N |
| XLogP | 6.56 |
| TPSA | 277.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|