C29H21N5O7S — CID 136609200
5-[[4-[4-[(2E)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 136609200) has the molecular formula C29H21N5O7S and a molecular weight of 583.58 g/mol. Its IUPAC name is 5-[[4-[4-[(2E)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[4-[(2E)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136609200 |
| Molecular Formula | C29H21N5O7S |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | 5-[[4-[4-[(2E)-2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1ccc2c(c1)C(=O)/C(=N\Nc1ccc(-c3ccc(/N=N/c4ccc(O)c(C(=O)O)c4)cc3)cc1)C(S(=O)(=O)O)=C2 |
| InChI | InChI=1S/C29H21N5O7S/c30-19-6-1-18-13-26(42(39,40)41)27(28(36)23(18)14-19)34-32-21-9-4-17(5-10-21)16-2-7-20(8-3-16)31-33-22-11-12-25(35)24(15-22)29(37)38/h1-15,32,35H,30H2,(H,37,38)(H,39,40,41)/b33-31+,34-27- |
| InChIKey | PTNKNLDLZKWLQB-XDJBPYLBSA-N |
| XLogP | 5.65 |
| TPSA | 204.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|