C34H28N6O11S3 — CID 71439467
5-amino-3-[[4-[4-[2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid (PubChem CID 71439467) has the molecular formula C34H28N6O11S3 and a molecular weight of 792.83 g/mol. Its IUPAC name is 5-amino-3-[[4-[4-[2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[[4-[4-[2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 71439467 |
| Molecular Formula | C34H28N6O11S3 |
| Molecular Weight | 792.83 g/mol |
| Exact Mass | 792.10 |
| IUPAC Name | 5-amino-3-[[4-[4-[2-(7-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-methylphenyl]-2-methylphenyl]hydrazinylidene]-4-oxonaphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(-c2ccc(NN=C3C(=O)c4c(N)cc(S(=O)(=O)O)cc4C=C3S(=O)(=O)O)c(C)c2)ccc1NN=C1C(=O)c2cc(N)ccc2C=C1S(=O)(=O)O |
| InChI | InChI=1S/C34H28N6O11S3/c1-16-9-18(4-7-26(16)37-39-31-28(53(46,47)48)12-20-3-6-22(35)14-24(20)33(31)41)19-5-8-27(17(2)10-19)38-40-32-29(54(49,50)51)13-21-11-23(52(43,44)45)15-25(36)30(21)34(32)42/h3-15,37-38H,35-36H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,49,50,51) |
| InChIKey | UJJUDNHYJUNKAO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 298.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|