C32H23N5O13S3 — CID 6912898
4-[[4-[4-[2-(6-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-hydroxyphenyl]-2-hydroxyphenyl]hydrazinylidene]-3-oxonaphthalene-2,7-disulfonic acid (PubChem CID 6912898) has the molecular formula C32H23N5O13S3 and a molecular weight of 781.76 g/mol. Its IUPAC name is 4-[[4-[4-[2-(6-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-hydroxyphenyl]-2-hydroxyphenyl]hydrazinylidene]-3-oxonaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[4-[4-[2-(6-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-hydroxyphenyl]-2-hydroxyphenyl]hydrazinylidene]-3-oxonaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 6912898 |
| Molecular Formula | C32H23N5O13S3 |
| Molecular Weight | 781.76 g/mol |
| Exact Mass | 781.05 |
| IUPAC Name | 4-[[4-[4-[2-(6-amino-1-oxo-3-sulfonaphthalen-2-ylidene)hydrazinyl]-3-hydroxyphenyl]-2-hydroxyphenyl]hydrazinylidene]-3-oxonaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc2c(c1)C=C(S(=O)(=O)O)C(=NNc1ccc(-c3ccc(NN=C4C(=O)C(S(=O)(=O)O)=Cc5cc(S(=O)(=O)O)ccc54)c(O)c3)cc1O)C2=O |
| InChI | InChI=1S/C32H23N5O13S3/c33-19-3-5-22-17(9-19)13-27(52(45,46)47)30(31(22)40)37-35-24-8-2-16(12-26(24)39)15-1-7-23(25(38)11-15)34-36-29-21-6-4-20(51(42,43)44)10-18(21)14-28(32(29)41)53(48,49)50/h1-14,34-35,38-39H,33H2,(H,42,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | HQYIVGSGDJHTKH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 312.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|