C32H25N7O8S2 — CID 54601412
(3E)-3-[(3-aminophenyl)hydrazinylidene]-7-[[(6Z)-6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonic acid (PubChem CID 54601412) has the molecular formula C32H25N7O8S2 and a molecular weight of 699.73 g/mol. Its IUPAC name is (3E)-3-[(3-aminophenyl)hydrazinylidene]-7-[[(6Z)-6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonic acid.
| Compound Name | (3E)-3-[(3-aminophenyl)hydrazinylidene]-7-[[(6Z)-6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 54601412 |
| Molecular Formula | C32H25N7O8S2 |
| Molecular Weight | 699.73 g/mol |
| Exact Mass | 699.12 |
| IUPAC Name | (3E)-3-[(3-aminophenyl)hydrazinylidene]-7-[[(6Z)-6-[(3-aminophenyl)hydrazinylidene]-5-oxo-7-sulfonaphthalen-2-yl]amino]-4-oxonaphthalene-2-sulfonic acid |
| SMILES | Nc1cccc(N/N=C2/C(=O)c3ccc(Nc4ccc5c(c4)C=C(S(=O)(=O)O)/C(=N/Nc4cccc(N)c4)C5=O)cc3C=C2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C32H25N7O8S2/c33-19-3-1-5-23(15-19)36-38-29-27(48(42,43)44)13-17-11-21(7-9-25(17)31(29)40)35-22-8-10-26-18(12-22)14-28(49(45,46)47)30(32(26)41)39-37-24-6-2-4-20(34)16-24/h1-16,35-37H,33-34H2,(H,42,43,44)(H,45,46,47)/b38-29-,39-30+ |
| InChIKey | GUXXLLAHPRKIPC-QNBCECBUSA-N |
| XLogP | 4.38 |
| TPSA | 255.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|