C29H20N6O8S2-2 — CID 6815936
7-[(3-aminobenzoyl)amino]-4-oxo-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonate (PubChem CID 6815936) has the molecular formula C29H20N6O8S2-2 and a molecular weight of 644.65 g/mol. Its IUPAC name is 7-[(3-aminobenzoyl)amino]-4-oxo-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonate.
| Compound Name | 7-[(3-aminobenzoyl)amino]-4-oxo-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 6815936 |
| Molecular Formula | C29H20N6O8S2-2 |
| Molecular Weight | 644.65 g/mol |
| Exact Mass | 644.08 |
| IUPAC Name | 7-[(3-aminobenzoyl)amino]-4-oxo-3-[[4-[(4-sulfonatophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonate |
| SMILES | Nc1cccc(C(=O)Nc2ccc3c(c2)C=C(S(=O)(=O)[O-])C(=NNc2ccc(/N=N/c4ccc(S(=O)(=O)[O-])cc4)cc2)C3=O)c1 |
| InChI | InChI=1S/C29H22N6O8S2/c30-19-3-1-2-17(14-19)29(37)31-23-10-13-25-18(15-23)16-26(45(41,42)43)27(28(25)36)35-34-21-6-4-20(5-7-21)32-33-22-8-11-24(12-9-22)44(38,39)40/h1-16,34H,30H2,(H,31,37)(H,38,39,40)(H,41,42,43)/p-2/b33-32+,35-27? |
| InChIKey | KMHULEGXFVTGDQ-ZVFXJWGNSA-L |
| XLogP | 4.39 |
| TPSA | 235.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|