C36H26N6O9S2 — CID 6787005
7-[(4-benzamidobenzoyl)amino]-3-[[4-[(4-hydroperoxysulfinylphenyl)diazenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfinoperoxoic acid (PubChem CID 6787005) has the molecular formula C36H26N6O9S2 and a molecular weight of 750.77 g/mol. Its IUPAC name is 7-[(4-benzamidobenzoyl)amino]-3-[[4-[(4-hydroperoxysulfinylphenyl)diazenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfinoperoxoic acid.
| Compound Name | 7-[(4-benzamidobenzoyl)amino]-3-[[4-[(4-hydroperoxysulfinylphenyl)diazenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfinoperoxoic acid |
|---|---|
| PubChem CID | 6787005 |
| Molecular Formula | C36H26N6O9S2 |
| Molecular Weight | 750.77 g/mol |
| Exact Mass | 750.12 |
| IUPAC Name | 7-[(4-benzamidobenzoyl)amino]-3-[[4-[(4-hydroperoxysulfinylphenyl)diazenyl]phenyl]hydrazinylidene]-4-oxonaphthalene-2-sulfinoperoxoic acid |
| SMILES | O=C(Nc1ccc(C(=O)Nc2ccc3c(c2)C=C(S(=O)OO)C(=NNc2ccc(/N=N/c4ccc(S(=O)OO)cc4)cc2)C3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H26N6O9S2/c43-34-31-19-16-29(38-36(45)23-6-8-25(9-7-23)37-35(44)22-4-2-1-3-5-22)20-24(31)21-32(53(49)51-47)33(34)42-41-27-12-10-26(11-13-27)39-40-28-14-17-30(18-15-28)52(48)50-46/h1-21,41,46-47H,(H,37,44)(H,38,45)/b40-39+,42-33? |
| InChIKey | FEBYQEWWWSHUCS-ANEGVNBDSA-N |
| XLogP | 7.28 |
| TPSA | 217.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|