C30H22N4O9S2 — CID 136897508
N-[(7Z)-7-[(4-benzamidophenyl)hydrazinylidene]-8-oxo-3,6-disulfonaphthalen-1-yl]benzenecarboximidic acid (PubChem CID 136897508) has the molecular formula C30H22N4O9S2 and a molecular weight of 646.66 g/mol. Its IUPAC name is N-[(7Z)-7-[(4-benzamidophenyl)hydrazinylidene]-8-oxo-3,6-disulfonaphthalen-1-yl]benzenecarboximidic acid.
| Compound Name | N-[(7Z)-7-[(4-benzamidophenyl)hydrazinylidene]-8-oxo-3,6-disulfonaphthalen-1-yl]benzenecarboximidic acid |
|---|---|
| PubChem CID | 136897508 |
| Molecular Formula | C30H22N4O9S2 |
| Molecular Weight | 646.66 g/mol |
| Exact Mass | 646.08 |
| IUPAC Name | N-[(7Z)-7-[(4-benzamidophenyl)hydrazinylidene]-8-oxo-3,6-disulfonaphthalen-1-yl]benzenecarboximidic acid |
| SMILES | O=C(Nc1ccc(N/N=C2/C(=O)c3c(cc(S(=O)(=O)O)cc3/N=C(\O)c3ccccc3)C=C2S(=O)(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H22N4O9S2/c35-28-26-20(15-23(44(38,39)40)17-24(26)32-30(37)19-9-5-2-6-10-19)16-25(45(41,42)43)27(28)34-33-22-13-11-21(12-14-22)31-29(36)18-7-3-1-4-8-18/h1-17,33H,(H,31,36)(H,32,37)(H,38,39,40)(H,41,42,43)/b34-27+ |
| InChIKey | ZVICZHBWEOTDLD-DNGXXSEMSA-N |
| XLogP | 4.72 |
| TPSA | 211.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|