C31H24N6O12S3 — CID 5479856
(3E)-6-acetamido-4-oxo-3-[[4-[[4-[(4-sulfophenyl)diazenyl]phenyl]carbamoyl]phenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid (PubChem CID 5479856) has the molecular formula C31H24N6O12S3 and a molecular weight of 768.76 g/mol. Its IUPAC name is (3E)-6-acetamido-4-oxo-3-[[4-[[4-[(4-sulfophenyl)diazenyl]phenyl]carbamoyl]phenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid.
| Compound Name | (3E)-6-acetamido-4-oxo-3-[[4-[[4-[(4-sulfophenyl)diazenyl]phenyl]carbamoyl]phenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 5479856 |
| Molecular Formula | C31H24N6O12S3 |
| Molecular Weight | 768.76 g/mol |
| Exact Mass | 768.06 |
| IUPAC Name | (3E)-6-acetamido-4-oxo-3-[[4-[[4-[(4-sulfophenyl)diazenyl]phenyl]carbamoyl]phenyl]hydrazinylidene]naphthalene-2,7-disulfonic acid |
| SMILES | CC(=O)Nc1cc2c(cc1S(=O)(=O)O)C=C(S(=O)(=O)O)/C(=N/Nc1ccc(C(=O)Nc3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4)cc3)cc1)C2=O |
| InChI | InChI=1S/C31H24N6O12S3/c1-17(38)32-26-16-25-19(14-27(26)51(44,45)46)15-28(52(47,48)49)29(30(25)39)37-36-21-4-2-18(3-5-21)31(40)33-20-6-8-22(9-7-20)34-35-23-10-12-24(13-11-23)50(41,42)43/h2-16,36H,1H3,(H,32,38)(H,33,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)/b35-34+,37-29- |
| InChIKey | FQFRSLWWEFZREW-BIICTCHJSA-N |
| XLogP | 4.70 |
| TPSA | 287.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|