C34H25N9O10S3 — CID 5474329
(3Z)-7-amino-4-oxo-8-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonic acid (PubChem CID 5474329) has the molecular formula C34H25N9O10S3 and a molecular weight of 815.83 g/mol. Its IUPAC name is (3Z)-7-amino-4-oxo-8-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonic acid.
| Compound Name | (3Z)-7-amino-4-oxo-8-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 5474329 |
| Molecular Formula | C34H25N9O10S3 |
| Molecular Weight | 815.83 g/mol |
| Exact Mass | 815.09 |
| IUPAC Name | (3Z)-7-amino-4-oxo-8-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]hydrazinylidene]naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2c(c1/N=N/c1ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc1)C=C(S(=O)(=O)O)/C(=N\Nc1ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc1)C2=O |
| InChI | InChI=1S/C34H25N9O10S3/c35-30-18-17-28-29(32(30)42-40-22-5-1-20(2-6-22)36-38-24-9-13-26(14-10-24)54(45,46)47)19-31(56(51,52)53)33(34(28)44)43-41-23-7-3-21(4-8-23)37-39-25-11-15-27(16-12-25)55(48,49)50/h1-19,41H,35H2,(H,45,46,47)(H,48,49,50)(H,51,52,53)/b38-36+,39-37+,42-40+,43-33+ |
| InChIKey | IPCUTOJIILLUSL-UJZHRZHUSA-N |
| XLogP | 7.90 |
| TPSA | 304.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.83 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|