C12H11N3NaO6S2 — CID 166600375
4,4''-(Diazoamino)dibenzenesulfonic acid disodium salt (PubChem CID 166600375) has the molecular formula C12H11N3NaO6S2 and a molecular weight of 380.36 g/mol.
| Compound Name | 4,4''-(Diazoamino)dibenzenesulfonic acid disodium salt |
|---|---|
| PubChem CID | 166600375 |
| Molecular Formula | C12H11N3NaO6S2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc(/N=N/Nc2ccc(S(=O)(=O)O)cc2)cc1.[Na] |
| InChI | InChI=1S/C12H11N3O6S2.Na/c16-22(17,18)11-5-1-9(2-6-11)13-15-14-10-3-7-12(8-4-10)23(19,20)21;/h1-8H,(H,13,14)(H,16,17,18)(H,19,20,21); |
| InChIKey | XUSILXIQWYXSKR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|