C19H17N3O6S2 — CID 168726206
4-[4-(methyldiazenyl)-N-(4-sulfophenyl)anilino]benzenesulfonic acid (PubChem CID 168726206) has the molecular formula C19H17N3O6S2 and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-[4-(methyldiazenyl)-N-(4-sulfophenyl)anilino]benzenesulfonic acid.
| Compound Name | 4-[4-(methyldiazenyl)-N-(4-sulfophenyl)anilino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168726206 |
| Molecular Formula | C19H17N3O6S2 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 4-[4-(methyldiazenyl)-N-(4-sulfophenyl)anilino]benzenesulfonic acid |
| SMILES | C/N=N/c1ccc(N(c2ccc(S(=O)(=O)O)cc2)c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O6S2/c1-20-21-14-2-4-15(5-3-14)22(16-6-10-18(11-7-16)29(23,24)25)17-8-12-19(13-9-17)30(26,27)28/h2-13H,1H3,(H,23,24,25)(H,26,27,28)/b21-20+ |
| InChIKey | HMDJYCTUYKUHCW-QZQOTICOSA-N |
| XLogP | 4.36 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|