C14H13N2O5S- — CID 136880485
2-ethyl-3-hydroxy-6-[(4-sulfophenyl)diazenyl]phenolate (PubChem CID 136880485) has the molecular formula C14H13N2O5S- and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-ethyl-3-hydroxy-6-[(4-sulfophenyl)diazenyl]phenolate.
| Compound Name | 2-ethyl-3-hydroxy-6-[(4-sulfophenyl)diazenyl]phenolate |
|---|---|
| PubChem CID | 136880485 |
| Molecular Formula | C14H13N2O5S- |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-ethyl-3-hydroxy-6-[(4-sulfophenyl)diazenyl]phenolate |
| SMILES | CCc1c(O)ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)c1[O-] |
| InChI | InChI=1S/C14H14N2O5S/c1-2-11-13(17)8-7-12(14(11)18)16-15-9-3-5-10(6-4-9)22(19,20)21/h3-8,17-18H,2H2,1H3,(H,19,20,21)/p-1/b16-15+ |
| InChIKey | LCLAZZORKKXDOR-FOCLMDBBSA-M |
| XLogP | 2.69 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|