C18H14N4Na2O8S2 — CID 170845739
CID 170845739 (PubChem CID 170845739) has the molecular formula C18H14N4Na2O8S2 and a molecular weight of 524.44 g/mol.
| Compound Name | CID 170845739 |
|---|---|
| PubChem CID | 170845739 |
| Molecular Formula | C18H14N4Na2O8S2 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2cc(/N=N/c3ccc(S(=O)(=O)O)cc3)c(O)cc2O)cc1.[Na].[Na] |
| InChI | InChI=1S/C18H14N4O8S2.2Na/c23-17-10-18(24)16(22-20-12-3-7-14(8-4-12)32(28,29)30)9-15(17)21-19-11-1-5-13(6-2-11)31(25,26)27;;/h1-10,23-24H,(H,25,26,27)(H,28,29,30);;/b21-19+,22-20+;; |
| InChIKey | HGLZVDQIHHSNMC-JXYRNBIZSA-N |
| XLogP | 3.66 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|