C27H20N4O9S — CID 165363694
5-[(3-carboxyphenyl)methyl]-2-[[2,4-dihydroxy-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]benzoic acid (PubChem CID 165363694) has the molecular formula C27H20N4O9S and a molecular weight of 576.54 g/mol. Its IUPAC name is 5-[(3-carboxyphenyl)methyl]-2-[[2,4-dihydroxy-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]benzoic acid.
| Compound Name | 5-[(3-carboxyphenyl)methyl]-2-[[2,4-dihydroxy-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 165363694 |
| Molecular Formula | C27H20N4O9S |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 5-[(3-carboxyphenyl)methyl]-2-[[2,4-dihydroxy-5-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cc2ccc(/N=N/c3cc(/N=N/c4ccc(S(=O)(=O)O)cc4)c(O)cc3O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C27H20N4O9S/c32-24-14-25(33)23(13-22(24)30-28-18-5-7-19(8-6-18)41(38,39)40)31-29-21-9-4-16(12-20(21)27(36)37)10-15-2-1-3-17(11-15)26(34)35/h1-9,11-14,32-33H,10H2,(H,34,35)(H,36,37)(H,38,39,40)/b30-28+,31-29+ |
| InChIKey | DBPKLWLFEXUDQN-FUEWEDNTSA-N |
| XLogP | 6.16 |
| TPSA | 218.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|