C20H18N4NaO5S — CID 170841045
CID 170841045 (PubChem CID 170841045) has the molecular formula C20H18N4NaO5S and a molecular weight of 449.44 g/mol.
| Compound Name | CID 170841045 |
|---|---|
| PubChem CID | 170841045 |
| Molecular Formula | C20H18N4NaO5S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | — |
| SMILES | Cc1ccc(/N=N/c2cc(/N=N/c3ccc(S(=O)(=O)O)cc3)c(O)cc2O)c(C)c1.[Na] |
| InChI | InChI=1S/C20H18N4O5S.Na/c1-12-3-8-16(13(2)9-12)22-24-18-10-17(19(25)11-20(18)26)23-21-14-4-6-15(7-5-14)30(27,28)29;/h3-11,25-26H,1-2H3,(H,27,28,29);/b23-21+,24-22+; |
| InChIKey | XRDCMSSUWQVRIC-BAYNMDCWSA-N |
| XLogP | 5.41 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|