C18H16N2O4S — CID 136794691
4-[(6-ethyl-2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonic acid (PubChem CID 136794691) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[(6-ethyl-2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(6-ethyl-2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136794691 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-[(6-ethyl-2-hydroxynaphthalen-1-yl)diazenyl]benzenesulfonic acid |
| SMILES | CCc1ccc2c(/N=N/c3ccc(S(=O)(=O)O)cc3)c(O)ccc2c1 |
| InChI | InChI=1S/C18H16N2O4S/c1-2-12-3-9-16-13(11-12)4-10-17(21)18(16)20-19-14-5-7-15(8-6-14)25(22,23)24/h3-11,21H,2H2,1H3,(H,22,23,24)/b20-19+ |
| InChIKey | ZSALBUKDAKWSOR-FMQUCBEESA-N |
| XLogP | 4.77 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|