C22H15N4NaO7S2 — CID 136502141
sodium 4-[[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate (PubChem CID 136502141) has the molecular formula C22H15N4NaO7S2 and a molecular weight of 534.51 g/mol. Its IUPAC name is sodium 4-[[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate.
| Compound Name | sodium 4-[[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 136502141 |
| Molecular Formula | C22H15N4NaO7S2 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | sodium 4-[[4-[(2-hydroxy-6-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(/N=N/c2ccc(/N=N/c3c(O)ccc4cc(S(=O)(=O)O)ccc34)cc2)cc1.[Na+] |
| InChI | InChI=1S/C22H16N4O7S2.Na/c27-21-12-1-14-13-19(35(31,32)33)10-11-20(14)22(21)26-25-16-4-2-15(3-5-16)23-24-17-6-8-18(9-7-17)34(28,29)30;/h1-13,27H,(H,28,29,30)(H,31,32,33);/q;+1/p-1/b24-23+,26-25+; |
| InChIKey | ILTGBRCWJYLHTC-HMNSNYPBSA-M |
| XLogP | 2.53 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|