C10H13KN3O4S+ — CID 126467905
potassium 4-(morpholin-4-yldiazenyl)benzenesulfonic acid (PubChem CID 126467905) has the molecular formula C10H13KN3O4S+ and a molecular weight of 310.40 g/mol. Its IUPAC name is potassium 4-(morpholin-4-yldiazenyl)benzenesulfonic acid.
| Compound Name | potassium 4-(morpholin-4-yldiazenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 126467905 |
| Molecular Formula | C10H13KN3O4S+ |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | potassium 4-(morpholin-4-yldiazenyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=N/N2CCOCC2)cc1.[K+] |
| InChI | InChI=1S/C10H13N3O4S.K/c14-18(15,16)10-3-1-9(2-4-10)11-12-13-5-7-17-8-6-13;/h1-4H,5-8H2,(H,14,15,16);/q;+1/b12-11+; |
| InChIKey | KYGDDWBRVZBRKT-CALJPSDSSA-N |
| XLogP | -1.73 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|