C12H15N4O4S- — CID 1235130
N-[4-(morpholin-4-yldiazenyl)phenyl]sulfonylethanimidate (PubChem CID 1235130) has the molecular formula C12H15N4O4S- and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[4-(morpholin-4-yldiazenyl)phenyl]sulfonylethanimidate.
| Compound Name | N-[4-(morpholin-4-yldiazenyl)phenyl]sulfonylethanimidate |
|---|---|
| PubChem CID | 1235130 |
| Molecular Formula | C12H15N4O4S- |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[4-(morpholin-4-yldiazenyl)phenyl]sulfonylethanimidate |
| SMILES | CC([O-])=NS(=O)(=O)c1ccc(/N=N/N2CCOCC2)cc1 |
| InChI | InChI=1S/C12H16N4O4S/c1-10(17)14-21(18,19)12-4-2-11(3-5-12)13-15-16-6-8-20-9-7-16/h2-5H,6-9H2,1H3,(H,14,17)/p-1/b15-13+ |
| InChIKey | SDBNAWOKRQYNRZ-FYWRMAATSA-M |
| XLogP | 0.48 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|