C16H20N6O3S — CID 25047791
N-(2,6-dimethylpyrimidin-4-yl)-4-(morpholin-4-yldiazenyl)benzenesulfonamide (PubChem CID 25047791) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(2,6-dimethylpyrimidin-4-yl)-4-(morpholin-4-yldiazenyl)benzenesulfonamide.
| Compound Name | N-(2,6-dimethylpyrimidin-4-yl)-4-(morpholin-4-yldiazenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 25047791 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-(2,6-dimethylpyrimidin-4-yl)-4-(morpholin-4-yldiazenyl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(/N=N/N3CCOCC3)cc2)nc(C)n1 |
| InChI | InChI=1S/C16H20N6O3S/c1-12-11-16(18-13(2)17-12)20-26(23,24)15-5-3-14(4-6-15)19-21-22-7-9-25-10-8-22/h3-6,11H,7-10H2,1-2H3,(H,17,18,20)/b21-19+ |
| InChIKey | XHVMQTKKPCUCIU-XUTLUUPISA-N |
| XLogP | 2.23 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|