C21H21N5O4S — CID 11797333
N-(2,6-dimethylpyrimidin-4-yl)-4-[(4,7-dioxo-1,3-dihydroisoindol-2-yl)methylamino]benzenesulfonamide (PubChem CID 11797333) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-(2,6-dimethylpyrimidin-4-yl)-4-[(4,7-dioxo-1,3-dihydroisoindol-2-yl)methylamino]benzenesulfonamide.
| Compound Name | N-(2,6-dimethylpyrimidin-4-yl)-4-[(4,7-dioxo-1,3-dihydroisoindol-2-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 11797333 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-(2,6-dimethylpyrimidin-4-yl)-4-[(4,7-dioxo-1,3-dihydroisoindol-2-yl)methylamino]benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NCN3CC4=C(C3)C(=O)C=CC4=O)cc2)nc(C)n1 |
| InChI | InChI=1S/C21H21N5O4S/c1-13-9-21(24-14(2)23-13)25-31(29,30)16-5-3-15(4-6-16)22-12-26-10-17-18(11-26)20(28)8-7-19(17)27/h3-9,22H,10-12H2,1-2H3,(H,23,24,25) |
| InChIKey | PAMNOSTZHLEOCE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|