C14H16ClN5O2S — CID 169368096
2-chloro-N'-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]ethanimidamide (PubChem CID 169368096) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is 2-chloro-N'-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368096 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-chloro-N'-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]ethanimidamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(/N=C(/N)CCl)cc2)nc(C)n1 |
| InChI | InChI=1S/C14H16ClN5O2S/c1-9-7-14(18-10(2)17-9)20-23(21,22)12-5-3-11(4-6-12)19-13(16)8-15/h3-7H,8H2,1-2H3,(H2,16,19)(H,17,18,20) |
| InChIKey | ZZFNGWOKDRBIIR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|