C9H11ClN4O3S — CID 169364990
[4-[(1-amino-2-chloroethylidene)amino]phenyl]sulfonylurea (PubChem CID 169364990) has the molecular formula C9H11ClN4O3S and a molecular weight of 290.73 g/mol. Its IUPAC name is [4-[(1-amino-2-chloroethylidene)amino]phenyl]sulfonylurea.
| Compound Name | [4-[(1-amino-2-chloroethylidene)amino]phenyl]sulfonylurea |
|---|---|
| PubChem CID | 169364990 |
| Molecular Formula | C9H11ClN4O3S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | [4-[(1-amino-2-chloroethylidene)amino]phenyl]sulfonylurea |
| SMILES | NC(=O)NS(=O)(=O)c1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C9H11ClN4O3S/c10-5-8(11)13-6-1-3-7(4-2-6)18(16,17)14-9(12)15/h1-4H,5H2,(H2,11,13)(H3,12,14,15) |
| InChIKey | PHIVQHNGIWAZFC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|