C8H7ClF2N2O — CID 169367099
2-chloro-N'-(3,5-difluoro-4-hydroxyphenyl)ethanimidamide (PubChem CID 169367099) has the molecular formula C8H7ClF2N2O and a molecular weight of 220.61 g/mol. Its IUPAC name is 2-chloro-N'-(3,5-difluoro-4-hydroxyphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(3,5-difluoro-4-hydroxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169367099 |
| Molecular Formula | C8H7ClF2N2O |
| Molecular Weight | 220.61 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-chloro-N'-(3,5-difluoro-4-hydroxyphenyl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C8H7ClF2N2O/c9-3-7(12)13-4-1-5(10)8(14)6(11)2-4/h1-2,14H,3H2,(H2,12,13) |
| InChIKey | ULNIOUFUTASPDY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|