C10H7ClF6N2 — CID 169369581
N'-[3,5-bis(trifluoromethyl)phenyl]-2-chloroethanimidamide (PubChem CID 169369581) has the molecular formula C10H7ClF6N2 and a molecular weight of 304.62 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-2-chloroethanimidamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169369581 |
| Molecular Formula | C10H7ClF6N2 |
| Molecular Weight | 304.62 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-2-chloroethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7ClF6N2/c11-4-8(18)19-7-2-5(9(12,13)14)1-6(3-7)10(15,16)17/h1-3H,4H2,(H2,18,19) |
| InChIKey | XXNYOUATQUGTTG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|