C9H5ClF6N2 — CID 169366173
2-chloro-N'-[2,3,4-trifluoro-5-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 169366173) has the molecular formula C9H5ClF6N2 and a molecular weight of 290.59 g/mol. Its IUPAC name is 2-chloro-N'-[2,3,4-trifluoro-5-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2,3,4-trifluoro-5-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366173 |
| Molecular Formula | C9H5ClF6N2 |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-chloro-N'-[2,3,4-trifluoro-5-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(C(F)(F)F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5ClF6N2/c10-2-5(17)18-4-1-3(9(14,15)16)6(11)8(13)7(4)12/h1H,2H2,(H2,17,18) |
| InChIKey | YYJZWFSUPXLNQC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|