C10H9ClF4N2 — CID 169366975
2-chloro-N'-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 169366975) has the molecular formula C10H9ClF4N2 and a molecular weight of 268.64 g/mol. Its IUPAC name is 2-chloro-N'-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366975 |
| Molecular Formula | C10H9ClF4N2 |
| Molecular Weight | 268.64 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-chloro-N'-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | Cc1cc(/N=C(/N)CCl)c(F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H9ClF4N2/c1-5-2-8(17-9(16)4-11)7(12)3-6(5)10(13,14)15/h2-3H,4H2,1H3,(H2,16,17) |
| InChIKey | GBAFOYDFBKKPDW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|