C12H14ClF3N2 — CID 169365282
2-chloro-N'-[4-propan-2-yl-2-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 169365282) has the molecular formula C12H14ClF3N2 and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-chloro-N'-[4-propan-2-yl-2-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-propan-2-yl-2-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169365282 |
| Molecular Formula | C12H14ClF3N2 |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-chloro-N'-[4-propan-2-yl-2-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | CC(C)c1ccc(/N=C(/N)CCl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14ClF3N2/c1-7(2)8-3-4-10(18-11(17)6-13)9(5-8)12(14,15)16/h3-5,7H,6H2,1-2H3,(H2,17,18) |
| InChIKey | XPJLOXSWZISENW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|