C14H19ClN2O — CID 169366148
N'-(4-acetyl-2-tert-butylphenyl)-2-chloroethanimidamide (PubChem CID 169366148) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is N'-(4-acetyl-2-tert-butylphenyl)-2-chloroethanimidamide.
| Compound Name | N'-(4-acetyl-2-tert-butylphenyl)-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169366148 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N'-(4-acetyl-2-tert-butylphenyl)-2-chloroethanimidamide |
| SMILES | CC(=O)c1ccc(/N=C(/N)CCl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19ClN2O/c1-9(18)10-5-6-12(17-13(16)8-15)11(7-10)14(2,3)4/h5-7H,8H2,1-4H3,(H2,16,17) |
| InChIKey | YFKWSQYTZWBAIS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|