C9H10ClN3O — CID 169369705
4-[(1-amino-2-chloroethylidene)amino]benzamide (PubChem CID 169369705) has the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. Its IUPAC name is 4-[(1-amino-2-chloroethylidene)amino]benzamide.
| Compound Name | 4-[(1-amino-2-chloroethylidene)amino]benzamide |
|---|---|
| PubChem CID | 169369705 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 4-[(1-amino-2-chloroethylidene)amino]benzamide |
| SMILES | NC(=O)c1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C9H10ClN3O/c10-5-8(11)13-7-3-1-6(2-4-7)9(12)14/h1-4H,5H2,(H2,11,13)(H2,12,14) |
| InChIKey | JPPNBDKUQDDXBM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|