C9H9ClN2O3 — CID 169365421
3-[(1-amino-2-chloroethylidene)amino]-5-hydroxybenzoic acid (PubChem CID 169365421) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is 3-[(1-amino-2-chloroethylidene)amino]-5-hydroxybenzoic acid.
| Compound Name | 3-[(1-amino-2-chloroethylidene)amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 169365421 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 3-[(1-amino-2-chloroethylidene)amino]-5-hydroxybenzoic acid |
| SMILES | N/C(CCl)=N/c1cc(O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H9ClN2O3/c10-4-8(11)12-6-1-5(9(14)15)2-7(13)3-6/h1-3,13H,4H2,(H2,11,12)(H,14,15) |
| InChIKey | XHFWUSCDUPBVQC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|