C9H10N2O3S — CID 10878855
3-[[amino(methylsulfanyl)methylidene]amino]-5-hydroxybenzoic acid (PubChem CID 10878855) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 3-[[amino(methylsulfanyl)methylidene]amino]-5-hydroxybenzoic acid.
| Compound Name | 3-[[amino(methylsulfanyl)methylidene]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 10878855 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3-[[amino(methylsulfanyl)methylidene]amino]-5-hydroxybenzoic acid |
| SMILES | CS/C(N)=N\c1cc(O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10N2O3S/c1-15-9(10)11-6-2-5(8(13)14)3-7(12)4-6/h2-4,12H,1H3,(H2,10,11)(H,13,14) |
| InChIKey | KVEYVODDXGOKCM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|