C10H13N5O4S — CID 168603146
3-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methylsulfonylbenzoic acid (PubChem CID 168603146) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is 3-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 168603146 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1cc(/N=C(\N)N=C(N)N)cc(C(=O)O)c1 |
| InChI | InChI=1S/C10H13N5O4S/c1-20(18,19)7-3-5(8(16)17)2-6(4-7)14-10(13)15-9(11)12/h2-4H,1H3,(H,16,17)(H6,11,12,13,14,15) |
| InChIKey | IIXYIXMAANWPGX-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|