C10H12F3N5O2S — CID 168604054
1-(diaminomethylidene)-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]guanidine (PubChem CID 168604054) has the molecular formula C10H12F3N5O2S and a molecular weight of 323.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 168604054 |
| Molecular Formula | C10H12F3N5O2S |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]guanidine |
| SMILES | CS(=O)(=O)c1ccc(/N=C(\N)N=C(N)N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H12F3N5O2S/c1-21(19,20)7-3-2-5(4-6(7)10(11,12)13)17-9(16)18-8(14)15/h2-4H,1H3,(H6,14,15,16,17,18) |
| InChIKey | PSWCIGBYRLSTMY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|