C16H22ClF4N5 — CID 162307887
N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-3,5-dimethylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 162307887) has the molecular formula C16H22ClF4N5 and a molecular weight of 395.83 g/mol. Its IUPAC name is N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-3,5-dimethylpiperidine-1-carboximidamide;hydrochloride.
| Compound Name | N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-3,5-dimethylpiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 162307887 |
| Molecular Formula | C16H22ClF4N5 |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-3,5-dimethylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | CC1CC(C)CN(C(N)=N/C(N)=N/c2ccc(F)c(C(F)(F)F)c2)C1.Cl |
| InChI | InChI=1S/C16H21F4N5.ClH/c1-9-5-10(2)8-25(7-9)15(22)24-14(21)23-11-3-4-13(17)12(6-11)16(18,19)20;/h3-4,6,9-10H,5,7-8H2,1-2H3,(H4,21,22,23,24);1H |
| InChIKey | SRNZZHTXSFRUFY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|