C15H20ClF4N5 — CID 169428657
N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-2-methylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 169428657) has the molecular formula C15H20ClF4N5 and a molecular weight of 381.81 g/mol. Its IUPAC name is N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-2-methylpiperidine-1-carboximidamide;hydrochloride.
| Compound Name | N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-2-methylpiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 169428657 |
| Molecular Formula | C15H20ClF4N5 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N'-[N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidoyl]-2-methylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | CC1CCCCN1C(N)=N/C(N)=N/c1ccc(F)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C15H19F4N5.ClH/c1-9-4-2-3-7-24(9)14(21)23-13(20)22-10-5-6-12(16)11(8-10)15(17,18)19;/h5-6,8-9H,2-4,7H2,1H3,(H4,20,21,22,23);1H |
| InChIKey | IZPBGYNWLKLWAH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|