C9H8F4N2S — CID 143864607
methyl N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 143864607) has the molecular formula C9H8F4N2S and a molecular weight of 252.24 g/mol. Its IUPAC name is methyl N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | methyl N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 143864607 |
| Molecular Formula | C9H8F4N2S |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl N'-[4-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | CS/C(N)=N\c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F4N2S/c1-16-8(14)15-5-2-3-7(10)6(4-5)9(11,12)13/h2-4H,1H3,(H2,14,15) |
| InChIKey | DCWTWLYODFEFPV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|